which description shows copper at rtp?
a) stationary and closed together
b) stationary and randomly arranged
c)vibrating and in a regular arrangement
d) vibrating and in a random arrangement

Answers

Answer 1

Answer:

c)vibrating and in a regular arrangement

Explanation:

Copper is a chemical element represented by the symbol Cu and having atomic number 29. Copper is a transition metal which means its subshells are not completely filled and that is why they are vibrating in the room temperature. But copper is a solid at room temperature with regular arrangement of atoms.

Hence, the correct answer is "c)vibrating and in a regular arrangement".


Related Questions

PLZ HELP!

What would happen to work and power if the mass of the person walking was increased or decreased? EXPLAIN.

Answers

Answer:

it would decrease  /  increase with the mass

Explanation:

Describe how you mathematically convert the measured mass of a
substance to moles? Create an example. PLEASE HELP

Answers

Answer:

no. of moles = measured mass of substance/ molar mass of the constituted elements

Explanation:

No. of moles of 2.0g NaCl= 2/(23+35.5) = 0.034mol

Giselle is working with a chemical substance in a laboratory. She observes that when the chemical is heated, it gives off a gas. She assumes that the gas is oxygen but decides to test this assumption to verify it. Which type of scientific knowledge is Giselle’s assumption?

Answers

The question is incomplete, the complete question is;

Giselle is working with a chemical substance in a laboratory. She observes that when the chemical is heated, it gives off a gas. She assumes that the gas is oxygen but decides to test this assumption to verify it. Which type of scientific knowledge is Giselle’s assumption?

A.

fact

B.

hypothesis

C.

law

D.

observation

E.

theory

Answer:

B.

hypothesis

Explanation:

A hypothesis is an intelligent guess put forward to explain an experimental observation. It is a tentative explanation for a scientific observation which must be subjected to careful verification.

Giselle’s assumption that the gas evolved is oxygen is a hypothesis. It must now be tested carefully in order to verify if the hypothesis is true.

⚠️help pls ⚠️
80 kg of element X decays so that 2.5 kilograms remain after 40.35 days.

a.What is the half-life of element X?

b. Identify element x.

C. Write a decay equation for the process.
⚠️WILL GIVE BRAINLIEST⚠️

Answers

Answer:

A half life of element is 8.07 days

B iodine 131

C check equation in attached image

Explanation:

80/2 =40

40/2=20

20/2=10

10/2=5

5/2=2.5

After 5 half lives it becomes 2.5 kg

n is the number of half-lives that pass in a given period of time

n= period of time/ half-life

Half life =period of time / n

Half life = 40.35/5= 8.07 days

odine-131 → xenon-131 + beta particle

What is the electron configuration of chlorine (CI)?
O 1s?2s?2p°3s?3p³
O 1s2s?2p3s?3p5
O 1s2s22p3s?4s?3p3
O 1s?2s?2p3s?3p²3d

Answers

Hello! :)

[tex]\large\boxed{1s^{2}2s^{2}2p^{6}3s^{2}3p^{5}}[/tex]

Chlorine is a halogen located in group 7A and period 3 of the periodic table.

We can write the electron configuration of this element. Since it is in period 3, the highest configuration level will be at 3.

Chlorine is also located in the p block (nonmetal) section of the table, so the final part of the written configuration will involve "3p".

Recall that:

S block: up to 2 electrons

P block: up to 6 electrons

Chlorine has 17 electrons

Fill in the order of s block to p block. The first level only goes up to an s block. The configuration should sum up to 17 total electrons in total.

We can write the configuration as:

[tex]1s^{2}2s^{2}2p^{6}3s^{2}3p^{5}[/tex]

12. Which of these elements is most likely to attract electrons from another atom during chemical bonding?
O 1) Fe
2) C
3) AI
4) Cs

Answers

I think the correct answer of these qusion is 2

Can someone help me with a Rocks Presentation that is worth 90 points?

Answers

Answer:

Sure!!! Is there a g-mail so I can get a hold of you?

Explanation:

A certain compound has the following percent composition: 57.1% C, 4.8% H, and 38.l% O.
If the molar mass of this compound is 126 g/mol, what is the molecular formula?

Answers

Answer:

C₆H₆O₃

Explanation:

Calculation sequence:

% => grams => moles => reduce => empirical Ratio

Molecular multiple = Molecular Mass / Empirical Mass

  C: => 57.1% => 57.1 g => 57.1/12 = 4.7583

  H: =>  4.8% =>  4.8 g =>   4.8/1  = 4.8000

  O: => 38.1% => 38.1 g => 38.1/16 = 2.3813

TTL => 100%       100 g

Reduced Mole values =>

C : H : O => 4.7583/2.3813 : 4.8000/2.3813 : 2.3813/2.3813 => 2 : 2 :  1

∴ empirical formula => C₂H₂O

empirical formula weight => 2C + 2H + 1O = [2(12) + 2(1) + 1(16)] amu = 42 amu

molecular formula weight (given in problem) = 126 g/mole

The molecular formula is a whole number multiple of the empirical formula.

molecular multiple = 126 amu / 42 amu = 3

∴ molecular formula => (C₂H₂O)₃ => C₆H₆O₃

1. What type of element (metal, nonmetal, metalloid) is present that accounts for the flame coloration?

Answers

Answer:

Metals i guess

Explanation:

Because each element has an exactly defined line emission spectrum, scientists are able to identify them by the color of flame they produce. For example, copper produces a blue flame, lithium and strontium a red flame, calcium an orange flame, sodium a yellow flame, and barium a green flame.

Suppose you were writing a summary of the article. Which of these will be most important to put in the summary?

Answers

Which of what? I don’t see a picture.

What would be the effect on the polarity of the molecule formed when CCl4 has one Cl replaced by an H?

Answers

Answer:

It will become polar.

Explanation:

Look the image below. I know it's terrible, but I'll explain it:

ΔE is the electronegativity. The higher is the ΔE of a substance, the more it can attracts electrons.

Cl has more electronegativity than C and H. But it has, of course, the same amount of another Cl.

So, when we have a tetrahedral space disposition such as in the left draw, all the Cl cancels the others eletrostatic force. However, when we replace one Cl for H, then we will have a dipole moment pointing to the Cl who face the Hydrogen, as the right draw. The appearance of a resulting dipole indicates the existence of a polar compound.

What type of thermal energy transfer best describes how the surface of the earth is?

Answers

Answer:

Convection

Explanation:

Convection is a form of thermal energy that rotates like, hot air goes up and cool air goes down. This happens in the squishy part of the Earth surface, that's why ppl say the more you dig the hotter it gets :)

Why are we measuring the bubbles to determine the rate of photosynthesis?

Answers

you measure the bubbles because oxygen is produced during photosynthesis so therefore by measuring the bubbles if you increase the water level you would see the rats of photosynthesis increase

Photosynthesis produces glucose and molecular oxygen. The bubbles formed here, is oxygen gas and which can be measured to determine the rate of photosynthesis.

What is photosynthesis?

Photosynthesis is a biochemical process by which plants produce energy and oxygen gas with the aid of light. Chlorophyll in green leaves are the photoactive substance which absorbs light energy.

The overall reaction of photosynthesis is written as below:

[tex]\rm 6H_{2}O (l) +6CO_{2} (g) \rightarrow C_{6}H_{6}O_{12}(aq) +6 O_{2} (g)[/tex]

Here, six moles of water and 6 moles of carbon dioxide reacts together to form glucose and 6 moles of oxygen.

The rate of a reaction can be determined by analyzing the product formed at regular interval. Therefore, by measuring the oxygen gas released from photosynthetic reaction in the form of bubbles the rate of reaction can be studied.

To find more about photosynthesis, refer the link below:

https://brainly.com/question/1757345

#SPJ2

How much of the electromagnetic spectrum is visible to us
A. all of it
B. None of it
C. Most of it
D. A small part of it

Answers

I think it’s all of it I hope this helps

Is dihydrogen monoxide a real substance? Do you think it should be banned?

Answers

Yes it’s a real substance and yes it should be banned because it kills people without warning.It has no taste,smell,and you can’t see it.

Geologists apply various methods to study the layers of the earth. Which if the following is a method used to study the deaths layers

Answers

Answer: ???

Explanation:???

Would a tighter or a looser cover heat the oven faster? How about no covering at all?

Answers

a tighter cover because of the gas particles , the gas particles would be trapped causing it to heat up faster. no covering at all would make it heat up the slowest

(05 06 MC) The theoretical yields of Cl2 from certain starting amounts of MnO2 and HCl were calculated as 65.36 g and 68.08 g, respectively.

If the percentage yield of Cl2 is 70%, what is its actual yield?

42.25g
45.65g
46.33g
47.66g​

Answers

Actual yield : 45.752 g ⇒no option

Further explanation

Given

The theoretical yields of Cl₂ : 65.35 g and 68.08 g

Required

The actual yield

Solution

Reaction

4 HCl (aq) + MnO₂ (s) → MnCl₂ (aq) + Cl₂ (g) + 2H₂O (l)

Because there are two theoretical yields, then we can choose the smallest one because the value is usually determined from the limiting reactant (in this reaction the limiting reactant is MnO₂)

So 65.36 g is The theoretical yields of Cl₂

Then the actual yield :

[tex]\tt \%yield=\dfrac{actual}{theoretical}\times 100\%\\\\actual=\%yield\times theoretical\\\\actual=70\%\times 65.36=45.752[/tex]

Which change will decrease the electric force between two positively charged objects? moving them closer together moving them farther apart adding neutrons removing electrons

Answers

Answer:

Moving them farther apart

Explanation:

One can try to change the distance between the two positive charges in such a way that it increases the distance and decreased the electric force.

Answer:

moving them farther apart

Explanation:

aka B.

Which element has the same number of energy levels as aluminum (Al) and the same number of valence electrons as calcium (Ca)

Answers

Answer:

magnesium (Mg)

Explanation:

Answer:

Be (Beryllium)

Explanation:

How many grams are in 1.76 x 10^23 atoms of iodine

Answers

Answer:

[tex]\boxed {\boxed {\sf About \ 37.1 \ grams \ of \ iodine }}[/tex]

Explanation:

To convert from atoms to grams, you must first convert atoms to moles, then moles to grams.

1. Convert Atoms to Moles

To convert atoms to grams, Avogadro's number must be used.

[tex]6.022*10^{23}[/tex]

This number tells us the number of particles (atoms, molecules, ions, etc.) in 1 mole. In this case, the particles are atoms of iodine.

[tex]\frac{6.022*10^{23} \ atoms \ I }{1 \ mol \ I}[/tex]

Multiply the given number of atoms by Avogadro's number.

[tex]1.76*10^{23} \ atoms \ I*\frac{6.022*10^{23} \ atoms \ I }{1 \ mol \ I}[/tex]

Flip the fraction so the atoms of iodine will cancel out.

[tex]1.76*10^{23} \ atoms \ I*\frac{ 1 \ mol \ I}{6.022*10^{23} \ atoms \ I}[/tex]

[tex]1.76*10^{23}* \frac{1 \ mol \ I}{6.022*10^{23} }[/tex]

Multiply so the problem condenses into 1 fraction.

[tex]\frac{1.76*10^{23} \ mol \ I}{6.022*10^{23} }[/tex]

[tex]0.2922617071 \ mol \ I[/tex]

2. Convert Moles to Grams

Now we must use the molar mass of iodine, which is found on the Periodic Table.

Iodine Molar Mass: 126.9045 g/mol

Use this mass as a fraction.

[tex]\frac{ 126.9045 \ g\ I }{ 1 \ mol \ I}[/tex]

Multiply this fraction by the number of moles found above.

[tex]0.2922617071 \ mol \ I*\frac{ 126.9045 \ g\ I }{ 1 \ mol \ I}[/tex]

Multiply. The moles of iodine will cancel.

[tex]0.2922617071 *\frac{ 126.9045 \ g\ I }{ 1 }[/tex]

The 1 as a denominator is insignificant.

[tex]0.2922617071 *{ 126.9045 \ g\ I }[/tex]

[tex]37.08932581 \ g \ I[/tex]

3. Round

The original measurement of 1.76*10^23 has 3 significant figures (1, 7, and 6). Therefore we must round our answer to 3 sig figs. For this answer, that is the tenths place.

[tex]37.08932581 \ g \ I[/tex]

The 8 in the hundredth place tells us to round the 0 up to a 1.

[tex]\approx 37.1\ g \ I[/tex]

There is about 37.1 grams of iodine in 1.76*10^23 atoms.

Explain the formation of an ionic compound between a metal and a non- metal by transfer of electrons with Mg as the metal and chlorine as the non metal to illustrate your answer. Give the reaction that occurs.

Answers

Answer: MgCl2

Explanation:

There will be two Chlorine atoms, and one Magnesium atom. The Mg atom will transfer one valence electron to each Chlorine atom to make them stable. I don't know the reaction that happens, I'm Sorryy. But yeah... have a nice day! :)

calculate the number of moles in 9 g of water​

Answers

Answer:

= 0.5 moles of water

[tex]formular \: mass \: of \: water \: = (2 \times 1) + 16 = 18 \\ 18g \: of \: water \: are \: weighed \: by \: 1 \: mole. \\ 9g \: will \: be \: weighed \: by \: \frac{9 \times 1}{18} \\ = \frac{9}{18} moles \\ = 0.5 \: moles \: of \: water[/tex]

Answer:

0.5 mole

Explanation:

m(h2o)=2×1+16=18g

n=m÷Me=9÷18=0.5mole

What is an example of heating water until it boils?

Answers

When bubbles form they contain the water in a vapor form making steam
For example when your in the shower and the door is closed, steam gathers onto the mirror. It’s the same thing when you boil water it becomes steam-Water vapor

Table Salt or NaCl is composed of sodium and chlorine. While the individual elements of sodium and chlorine are very reactive, together they form a popular cooking and baking ingredient. In order to form a salt, an electron must be transferred from one element to the other. Which element (Na or Cl) is more likely to steal an outer electron from the other? Why?

Answers

Answer:

Chlorine is more likely to steal a valence electron from sodium.

Explanation:

Sodium is number 11 on the periodic table with one valence electron. Belonging to the first group, it's one of the alkali metal, which are known to be highly reactive. Chlorine is number 17 with seven valence electrons, and it's in the second-to-last group of halogens--also very reactive.

Considering that elements with one valence electron are just about 100% likely to give up electrons to reach a stable state, sodium would be the element that is more likely to lose its valence electron to chlorine. In other words, chlorine would be the electron thief.

What object can an S wave travel through?
-air
-magma
-soil
-water

Answers

Answer:

Magma

Explanation: cuz S waves travel through solids water, soil, and air are not solids so ur answer is B; magma

Answer:

c. soil

Explanation:

this is the correct answer not the one above...

Which kind of weather usually forms over the northwest United States in the summer because of maritime polar air masses? fog dry heat heavy snow heavy rain

Answers

Answer:

fog

Explanation:

Answer:

Fog :)

Explanation:

:) :) :) :) :) :) :) :) :) :) :) :) :)

OMG GUESS WHAT GUYS YAYAYA

Answers

Answer:

What What What

Explanation:

Answer:

HAPPY BIRTHDAY!

Explanation:

What's the molar mass of Cr(Cr2O7)3

Answers

Answer:

700 g/mol

General Formulas and Concepts:

Math

Pre-Algebra

Order of Operations: BPEMDAS

Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to Right

Chemistry

Atomic Structure

Reading a Periodic TableExplanation:

Step 1: Define

Cr(Cr₂O₇)₃

Step 2: Identify

Molar Mass of Cr - 52.00 g/mol

Molar Mass of O - 16.00 g/mol

Step 3: Find MM

Molar Mass of Cr(Cr₂O₇)₃ - 52.00 + 6(52.00) + 21(16.00) = 700 g/mol

Which of the following statements
is/are true about the region of the
atom labeled "x" in the attached
picture?

Answers

Explanation:

The region x of the atom shown is called the nucleus of the atom shown. The nucleus of an atom contains protons and neutrons.

Protons are the positively charged particles found in the nucleusNeutrons do not carry any charges. Together protons and neutrons determines the mass of the atom. The mass of an atom is concentrated in the nucleusBoth particles have equal masses

The region y is the atomic orbital where electrons can be found.

Other Questions
Provide two bullet point sentences in which you describe how Latin America curanderismo and US traditional medicine are similar Please help me answer this! Find the sum.(5p+11) + (8p- 4)A. 5p+7B. 13p-7C. 13p+7D. 13p+15AP3X Review the proof. Which step contains an errorStep 2Step 4Step 6Step 8 Order the set {-4 1/2 , 5.6, -2 3/8, and 1.35} from least to greatest. I already got my answer i just want to make sure since im studing for a test. Thank you! Which of the following statements BEST describes ASEXUAL reproduction?Question 8 options:A single-celled organism uses meiosis to create two identical copies of itself.Two multi-celled organisms uses meiosis and fertilization to create a unique offspring.Two multi-celled organisms use mitosis and fertilization to create a unique offspring.A single-celled organism uses mitosis to create two identical copies of itself. Brenda makes $95,000 per year.a. How much does Brenda have taken off in federal tax?b. How much does Brenda have taken off in NWT tax?c. What percent of taxes does Brenda have taken off her cheque? Round to thenearest decimal place. Do you think selling to different market segments is the best way for a small business to respond to increased competition ? Justify your answer Ashad is rewriting the expression 28 a + 36 a b as a product. Which statements about the expression are accurate and relevant to his rewriting the expression? Select three options.The GCF of the numbers in each term in the expression is 2.The GCF of the numbers in each term in the expression is 4.The GCF of the variables in each term in the expression is a.The factored form of the expression is 2 a (14 a + 18 a b).The factored form of the expression is 4 a (7 + 9 b). Meera paid $240 for 4 pairs of shoes and 4 pairs ofshorts. Each pair of shoes cost 4 times as much as a pair ofshorts. Find the difference in price between a pair of shoesand a pair of shorts. party trays, which cost $14.00 to make not including labor, are sold for $35.00. if two people work 8 hour shifts making the trays at $7.00 per hour, how many trays must be sold to cover all cost including labor? Qin shihuangdi goals for the qin dynasty Four runners are training for long races. Noah ran 5.123 miles, Andre ran 6.34 miles, Jada ran 7.1 miles, and Diego ran 8 miles.Jada ran how much farther than Noah? n 200 BC, took control of Judea. Later, the Maccabees led a rebellion, and Judea became independent.In 63 BC, the powerful conquered Judea. During their rule, many Jews migrated away from Jerusalem. They continued to practice their religion in under the leadership of rabbis. 4=(k86)+10solve for k Which leader negotiated a trade treaty between the US and Great Britain on behalf of George Washington?John JayThomas JeffersonAlexander HamiltonNapoleon Bonaparte Which physical feature is used to divide the eastern and western United States? A- the Mississippi river B- Rocky MountainsC- great plains D-Appalachian mountains Which are undefined?sec(-pi/)csc(3pi)cot(7pi/2)csc(-3pi/2)cot(5pi/3) what are the intercepts of the equation -2A+2y = -8 What is the domain and range for the function graphed below Steam Workshop Downloader